C7H18NO8P — CID 175400653
[bis(2-hydroxyethyl)amino] 2,3-dihydroxypropyl hydrogen phosphate (PubChem CID 175400653) has the molecular formula C7H18NO8P and a molecular weight of 275.19 g/mol. Its IUPAC name is [bis(2-hydroxyethyl)amino] 2,3-dihydroxypropyl hydrogen phosphate.
| Compound Name | [bis(2-hydroxyethyl)amino] 2,3-dihydroxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 175400653 |
| Molecular Formula | C7H18NO8P |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [bis(2-hydroxyethyl)amino] 2,3-dihydroxypropyl hydrogen phosphate |
| SMILES | O=P(O)(OCC(O)CO)ON(CCO)CCO |
| InChI | InChI=1S/C7H18NO8P/c9-3-1-8(2-4-10)16-17(13,14)15-6-7(12)5-11/h7,9-12H,1-6H2,(H,13,14) |
| InChIKey | ZRPFDCXYBGZDME-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|