C14H32NO6P — CID 172699955
[(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)octan-2-yl phosphate (PubChem CID 172699955) has the molecular formula C14H32NO6P and a molecular weight of 341.39 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)octan-2-yl phosphate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)octan-2-yl phosphate |
|---|---|
| PubChem CID | 172699955 |
| Molecular Formula | C14H32NO6P |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)octan-2-yl phosphate |
| SMILES | CCCCCCC(C[N+](C)(C)C)OP(=O)([O-])OC[C@H](O)CO |
| InChI | InChI=1S/C14H32NO6P/c1-5-6-7-8-9-14(10-15(2,3)4)21-22(18,19)20-12-13(17)11-16/h13-14,16-17H,5-12H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | CVEUMFIXNQKMJF-KWCCSABGSA-N |
| XLogP | 0.89 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|