C13H28NO7P — CID 87368780
[2,3-dihydroxypropoxy-[(2-methylpropan-2-yl)oxy]phosphoryl] 2-aminohexanoate (PubChem CID 87368780) has the molecular formula C13H28NO7P and a molecular weight of 341.34 g/mol. Its IUPAC name is [2,3-dihydroxypropoxy-[(2-methylpropan-2-yl)oxy]phosphoryl] 2-aminohexanoate.
| Compound Name | [2,3-dihydroxypropoxy-[(2-methylpropan-2-yl)oxy]phosphoryl] 2-aminohexanoate |
|---|---|
| PubChem CID | 87368780 |
| Molecular Formula | C13H28NO7P |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [2,3-dihydroxypropoxy-[(2-methylpropan-2-yl)oxy]phosphoryl] 2-aminohexanoate |
| SMILES | CCCCC(N)C(=O)OP(=O)(OCC(O)CO)OC(C)(C)C |
| InChI | InChI=1S/C13H28NO7P/c1-5-6-7-11(14)12(17)20-22(18,21-13(2,3)4)19-9-10(16)8-15/h10-11,15-16H,5-9,14H2,1-4H3 |
| InChIKey | FJXUOXSLVOEYHY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|