C23H45NO7P- — CID 91666406
[(2R)-2,3-dihydroxypropyl] 2-[[(Z)-octadec-9-enoyl]amino]ethyl phosphate (PubChem CID 91666406) has the molecular formula C23H45NO7P- and a molecular weight of 478.59 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] 2-[[(Z)-octadec-9-enoyl]amino]ethyl phosphate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] 2-[[(Z)-octadec-9-enoyl]amino]ethyl phosphate |
|---|---|
| PubChem CID | 91666406 |
| Molecular Formula | C23H45NO7P- |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] 2-[[(Z)-octadec-9-enoyl]amino]ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCOP(=O)([O-])OC[C@H](O)CO |
| InChI | InChI=1S/C23H46NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)24-18-19-30-32(28,29)31-21-22(26)20-25/h9-10,22,25-26H,2-8,11-21H2,1H3,(H,24,27)(H,28,29)/p-1/b10-9-/t22-/m1/s1 |
| InChIKey | VBNXVCGZJCGEKO-MZMPXXGTSA-M |
| XLogP | 3.99 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|