C15H31N2O7P — CID 168888387
[2-(hydroxymethyl)-6-[[5-(methylamino)-5-oxopentanoyl]amino]hexyl] dimethyl phosphate (PubChem CID 168888387) has the molecular formula C15H31N2O7P and a molecular weight of 382.39 g/mol. Its IUPAC name is [2-(hydroxymethyl)-6-[[5-(methylamino)-5-oxopentanoyl]amino]hexyl] dimethyl phosphate.
| Compound Name | [2-(hydroxymethyl)-6-[[5-(methylamino)-5-oxopentanoyl]amino]hexyl] dimethyl phosphate |
|---|---|
| PubChem CID | 168888387 |
| Molecular Formula | C15H31N2O7P |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-(hydroxymethyl)-6-[[5-(methylamino)-5-oxopentanoyl]amino]hexyl] dimethyl phosphate |
| SMILES | CNC(=O)CCCC(=O)NCCCCC(CO)COP(=O)(OC)OC |
| InChI | InChI=1S/C15H31N2O7P/c1-16-14(19)8-6-9-15(20)17-10-5-4-7-13(11-18)12-24-25(21,22-2)23-3/h13,18H,4-12H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | OKIVRCMQCLXKCY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|