C11H24FNO3 — CID 153371017
[6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;ethane (PubChem CID 153371017) has the molecular formula C11H24FNO3 and a molecular weight of 237.31 g/mol. Its IUPAC name is [6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;ethane.
| Compound Name | [6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;ethane |
|---|---|
| PubChem CID | 153371017 |
| Molecular Formula | C11H24FNO3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | [6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;ethane |
| SMILES | CC.CC(=O)NCCCCC(CO)COF |
| InChI | InChI=1S/C9H18FNO3.C2H6/c1-8(13)11-5-3-2-4-9(6-12)7-14-10;1-2/h9,12H,2-7H2,1H3,(H,11,13);1-2H3 |
| InChIKey | KMENLAYEETVJGA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|