About boric acid;3-methylpyridine;tetrafluoroborate
boric acid;3-methylpyridine;tetrafluoroborate (PubChem CID 174506250) has the molecular formula C6H10B2F4NO3-
and a molecular weight of 241.77 g/mol. Its IUPAC name is boric acid;3-methylpyridine;tetrafluoroborate.
Molecular Properties
| Compound Name | boric acid;3-methylpyridine;tetrafluoroborate |
| PubChem CID | 174506250 |
| Molecular Formula | C6H10B2F4NO3- |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | boric acid;3-methylpyridine;tetrafluoroborate |
| SMILES | Cc1cccnc1.F[B-](F)(F)F.OB(O)O |
| InChI | InChI=1S/C6H7N.BF4.BH3O3/c1-6-3-2-4-7-5-6;2-1(3,4)5;2-1(3)4/h2-5H,1H3;;2-4H/q;-1; |
| InChIKey | AWNXJVOAVKZQIZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;3-methylpyridine;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;3-methylpyridine;tetrafluoroborate?
The IUPAC name of boric acid;3-methylpyridine;tetrafluoroborate (CID 174506250) is boric acid;3-methylpyridine;tetrafluoroborate.
What is the SMILES notation for boric acid;3-methylpyridine;tetrafluoroborate?
The canonical SMILES for boric acid;3-methylpyridine;tetrafluoroborate is Cc1cccnc1.F[B-](F)(F)F.OB(O)O.
What is the InChIKey of boric acid;3-methylpyridine;tetrafluoroborate?
The InChIKey is AWNXJVOAVKZQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.BF4.BH3O3/c1-6-3-2-4-7-5-6;2-1(3,4)5;2-1(3)4/h2-5H,1H3;;2-4H/q;-1;.
What are the key properties of boric acid;3-methylpyridine;tetrafluoroborate?
boric acid;3-methylpyridine;tetrafluoroborate has a molecular weight of 241.77 g/mol, XLogP of 0.64, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;3-methylpyridine;tetrafluoroborate is sourced from PubChem (CID 174506250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).