C13H23BO5 — CID 71116543
2,3-dimethylbutane-2,3-diol;(4-methoxyphenyl)boronic acid (PubChem CID 71116543) has the molecular formula C13H23BO5 and a molecular weight of 270.13 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;(4-methoxyphenyl)boronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;(4-methoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 71116543 |
| Molecular Formula | C13H23BO5 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;(4-methoxyphenyl)boronic acid |
| SMILES | CC(C)(O)C(C)(C)O.COc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C7H9BO3.C6H14O2/c1-11-7-4-2-6(3-5-7)8(9)10;1-5(2,7)6(3,4)8/h2-5,9-10H,1H3;7-8H,1-4H3 |
| InChIKey | KGPIPIXYBLQNCC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|