C18H18N3O2+ — CID 7524169
(4Z)-2-amino-3-methyl-4-[(4-phenylmethoxyphenyl)methylidene]-1H-imidazol-3-ium-5-one (PubChem CID 7524169) has the molecular formula C18H18N3O2+ and a molecular weight of 308.36 g/mol. Its IUPAC name is (4Z)-2-amino-3-methyl-4-[(4-phenylmethoxyphenyl)methylidene]-1H-imidazol-3-ium-5-one.
| Compound Name | (4Z)-2-amino-3-methyl-4-[(4-phenylmethoxyphenyl)methylidene]-1H-imidazol-3-ium-5-one |
|---|---|
| PubChem CID | 7524169 |
| Molecular Formula | C18H18N3O2+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (4Z)-2-amino-3-methyl-4-[(4-phenylmethoxyphenyl)methylidene]-1H-imidazol-3-ium-5-one |
| SMILES | C[N+]1=C(N)NC(=O)/C1=C/c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N3O2/c1-21-16(17(22)20-18(21)19)11-13-7-9-15(10-8-13)23-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H2,19,20,22)/p+1/b16-11- |
| InChIKey | HMFJZKNVEHWZIX-WJDWOHSUSA-O |
| XLogP | 1.69 |
| TPSA | 67.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|