C35H32O7 — CID 4736130
ethyl 4-[5-[[3-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-5-methyl-2-oxocyclohexylidene]methyl]furan-2-yl]benzoate (PubChem CID 4736130) has the molecular formula C35H32O7 and a molecular weight of 564.63 g/mol. Its IUPAC name is ethyl 4-[5-[[3-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-5-methyl-2-oxocyclohexylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[3-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-5-methyl-2-oxocyclohexylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4736130 |
| Molecular Formula | C35H32O7 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | ethyl 4-[5-[[3-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-5-methyl-2-oxocyclohexylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3CC(C)CC(=Cc4ccc(-c5ccc(C(=O)OCC)cc5)o4)C3=O)o2)cc1 |
| InChI | InChI=1S/C35H32O7/c1-4-39-34(37)25-10-6-23(7-11-25)31-16-14-29(41-31)20-27-18-22(3)19-28(33(27)36)21-30-15-17-32(42-30)24-8-12-26(13-9-24)35(38)40-5-2/h6-17,20-22H,4-5,18-19H2,1-3H3 |
| InChIKey | YYMSHYXBIODENZ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 95.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|