C26H30O6 — CID 72807650
2,3-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]butanedial (PubChem CID 72807650) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2,3-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]butanedial.
| Compound Name | 2,3-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]butanedial |
|---|---|
| PubChem CID | 72807650 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2,3-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]butanedial |
| SMILES | COc1cc(C=C(C=O)C(C=O)=Cc2ccc(OC(C)C)c(OC)c2)ccc1OC(C)C |
| InChI | InChI=1S/C26H30O6/c1-17(2)31-23-9-7-19(13-25(23)29-5)11-21(15-27)22(16-28)12-20-8-10-24(32-18(3)4)26(14-20)30-6/h7-18H,1-6H3 |
| InChIKey | GOLKUXXELSAJSJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|