C18H22N2O3 — CID 6255693
(2E,5E)-2-[(3,4-dimethoxyphenyl)methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one (PubChem CID 6255693) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2E,5E)-2-[(3,4-dimethoxyphenyl)methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2-[(3,4-dimethoxyphenyl)methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 6255693 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2E,5E)-2-[(3,4-dimethoxyphenyl)methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one |
| SMILES | COc1ccc(/C=C2\CC/C(=C\C=N/N(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-20(2)19-10-9-14-6-7-15(18(14)21)11-13-5-8-16(22-3)17(12-13)23-4/h5,8-12H,6-7H2,1-4H3/b14-9+,15-11+,19-10- |
| InChIKey | UJYVAEJAXWSTDV-HWNUBBRMSA-N |
| XLogP | 2.92 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|