C25H29N3O4 — CID 6029117
(E)-2-cyano-N-(2-methoxyphenyl)-3-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]prop-2-enamide (PubChem CID 6029117) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-methoxyphenyl)-3-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-methoxyphenyl)-3-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6029117 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (E)-2-cyano-N-(2-methoxyphenyl)-3-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C/c1ccc(OCCN2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C25H29N3O4/c1-30-22-9-5-4-8-21(22)27-25(29)20(18-26)16-19-10-11-23(24(17-19)31-2)32-15-14-28-12-6-3-7-13-28/h4-5,8-11,16-17H,3,6-7,12-15H2,1-2H3,(H,27,29)/b20-16+ |
| InChIKey | VAMXCSXPRONHIC-CAPFRKAQSA-N |
| XLogP | 4.11 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|