C19H26O6 — CID 91354224
ethyl 3-[4-(2-methoxyethoxy)-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 91354224) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethyl 3-[4-(2-methoxyethoxy)-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-(2-methoxyethoxy)-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91354224 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | ethyl 3-[4-(2-methoxyethoxy)-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OCCOC)cc1OCC1CCCO1 |
| InChI | InChI=1S/C19H26O6/c1-3-22-19(20)9-7-15-6-8-16(24-12-11-21-2)13-18(15)25-14-17-5-4-10-23-17/h6-9,13,17H,3-5,10-12,14H2,1-2H3 |
| InChIKey | SANBVHAQTRBFAR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|