C46H48OP2Si — CID 58729439
[13-[tert-butyl(dimethyl)silyl]oxy-11-diphenylphosphanyl-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-diphenylphosphane (PubChem CID 58729439) has the molecular formula C46H48OP2Si and a molecular weight of 706.92 g/mol. Its IUPAC name is [13-[tert-butyl(dimethyl)silyl]oxy-11-diphenylphosphanyl-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-diphenylphosphane.
| Compound Name | [13-[tert-butyl(dimethyl)silyl]oxy-11-diphenylphosphanyl-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 58729439 |
| Molecular Formula | C46H48OP2Si |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 706.29 |
| IUPAC Name | [13-[tert-butyl(dimethyl)silyl]oxy-11-diphenylphosphanyl-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-diphenylphosphane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc2c(P(c3ccccc3)c3ccccc3)cc1CCc1ccc(cc1P(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C46H48OP2Si/c1-46(2,3)50(4,5)47-43-33-38-29-27-35-26-28-36(44(32-35)48(39-18-10-6-11-19-39)40-20-12-7-13-21-40)30-31-37(43)34-45(38)49(41-22-14-8-15-23-41)42-24-16-9-17-25-42/h6-26,28,32-34H,27,29-31H2,1-5H3 |
| InChIKey | WNBPTAGYIFEORV-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|