About [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite
[4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite (PubChem CID 102007550) has the molecular formula C28H38O4P2Si
and a molecular weight of 528.64 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite.
Molecular Properties
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite |
| PubChem CID | 102007550 |
| Molecular Formula | C28H38O4P2Si |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite |
| SMILES | CCOP(OCC)Oc1ccc(O[Si](C)(C)C(C)(C)C)cc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H38O4P2Si/c1-8-29-34(30-9-2)31-26-21-20-23(32-35(6,7)28(3,4)5)22-27(26)33(24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-22H,8-9H2,1-7H3 |
| InChIKey | YCUVGWQJLSBFQA-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite?
The IUPAC name of [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite (CID 102007550) is [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite.
What is the SMILES notation for [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite?
The canonical SMILES for [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite is CCOP(OCC)Oc1ccc(O[Si](C)(C)C(C)(C)C)cc1P(c1ccccc1)c1ccccc1.
What is the InChIKey of [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite?
The InChIKey is YCUVGWQJLSBFQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38O4P2Si/c1-8-29-34(30-9-2)31-26-21-20-23(32-35(6,7)28(3,4)5)22-27(26)33(24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-22H,8-9H2,1-7H3.
What are the key properties of [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite?
[4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite has a molecular weight of 528.64 g/mol, XLogP of 7.51, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[tert-butyl(dimethyl)silyl]oxy-2-diphenylphosphanylphenyl] diethyl phosphite is sourced from PubChem (CID 102007550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).