C26H24ClPSi — CID 132544670
[6-[chloro(dimethyl)silyl]-1,2-dihydroacenaphthylen-5-yl]-diphenylphosphane (PubChem CID 132544670) has the molecular formula C26H24ClPSi and a molecular weight of 430.99 g/mol. Its IUPAC name is [6-[chloro(dimethyl)silyl]-1,2-dihydroacenaphthylen-5-yl]-diphenylphosphane.
| Compound Name | [6-[chloro(dimethyl)silyl]-1,2-dihydroacenaphthylen-5-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 132544670 |
| Molecular Formula | C26H24ClPSi |
| Molecular Weight | 430.99 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [6-[chloro(dimethyl)silyl]-1,2-dihydroacenaphthylen-5-yl]-diphenylphosphane |
| SMILES | C[Si](C)(Cl)c1ccc2c3c(ccc(P(c4ccccc4)c4ccccc4)c13)CC2 |
| InChI | InChI=1S/C26H24ClPSi/c1-29(2,27)24-18-16-20-14-13-19-15-17-23(26(24)25(19)20)28(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,15-18H,13-14H2,1-2H3 |
| InChIKey | RSAPHFMQSYNBIY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.99 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|