C48H54P2Pd+2 — CID 19087177
palladium(2+);bis(tris(2,4-dimethylphenyl)phosphane) (PubChem CID 19087177) has the molecular formula C48H54P2Pd+2 and a molecular weight of 799.33 g/mol. Its IUPAC name is palladium(2+);bis(tris(2,4-dimethylphenyl)phosphane).
| Compound Name | palladium(2+);bis(tris(2,4-dimethylphenyl)phosphane) |
|---|---|
| PubChem CID | 19087177 |
| Molecular Formula | C48H54P2Pd+2 |
| Molecular Weight | 799.33 g/mol |
| Exact Mass | 798.27 |
| IUPAC Name | palladium(2+);bis(tris(2,4-dimethylphenyl)phosphane) |
| SMILES | Cc1ccc(P(c2ccc(C)cc2C)c2ccc(C)cc2C)c(C)c1.Cc1ccc(P(c2ccc(C)cc2C)c2ccc(C)cc2C)c(C)c1.[Pd+2] |
| InChI | InChI=1S/2C24H27P.Pd/c2*1-16-7-10-22(19(4)13-16)25(23-11-8-17(2)14-20(23)5)24-12-9-18(3)15-21(24)6;/h2*7-15H,1-6H3;/q;;+2 |
| InChIKey | GSQVRQNMAMFOGX-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.33 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|