C24H27O2P — CID 23352982
bis(2,4-dimethylphenoxy)-(2,4-dimethylphenyl)phosphane (PubChem CID 23352982) has the molecular formula C24H27O2P and a molecular weight of 378.45 g/mol. Its IUPAC name is bis(2,4-dimethylphenoxy)-(2,4-dimethylphenyl)phosphane.
| Compound Name | bis(2,4-dimethylphenoxy)-(2,4-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 23352982 |
| Molecular Formula | C24H27O2P |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | bis(2,4-dimethylphenoxy)-(2,4-dimethylphenyl)phosphane |
| SMILES | Cc1ccc(OP(Oc2ccc(C)cc2C)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H27O2P/c1-16-7-10-22(19(4)13-16)25-27(24-12-9-18(3)15-21(24)6)26-23-11-8-17(2)14-20(23)5/h7-15H,1-6H3 |
| InChIKey | AQPLZZNTIOPXQJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|