C10H13BrN2S — CID 116509575
1-(2-bromo-4,6-dimethylphenyl)-3-methylthiourea (PubChem CID 116509575) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 1-(2-bromo-4,6-dimethylphenyl)-3-methylthiourea.
| Compound Name | 1-(2-bromo-4,6-dimethylphenyl)-3-methylthiourea |
|---|---|
| PubChem CID | 116509575 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 1-(2-bromo-4,6-dimethylphenyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C10H13BrN2S/c1-6-4-7(2)9(8(11)5-6)13-10(14)12-3/h4-5H,1-3H3,(H2,12,13,14) |
| InChIKey | MSQIFRBFVUNLRY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|