C8H7BrF2N2S — CID 19679745
1-(2-bromo-4,6-difluorophenyl)-3-methylthiourea (PubChem CID 19679745) has the molecular formula C8H7BrF2N2S and a molecular weight of 281.13 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3-methylthiourea.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3-methylthiourea |
|---|---|
| PubChem CID | 19679745 |
| Molecular Formula | C8H7BrF2N2S |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H7BrF2N2S/c1-12-8(14)13-7-5(9)2-4(10)3-6(7)11/h2-3H,1H3,(H2,12,13,14) |
| InChIKey | QZHWMNCNTJTKRQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|