C12H17BrN2S — CID 116509583
1-(2-bromo-4,6-dimethylphenyl)-3-propan-2-ylthiourea (PubChem CID 116509583) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 1-(2-bromo-4,6-dimethylphenyl)-3-propan-2-ylthiourea.
| Compound Name | 1-(2-bromo-4,6-dimethylphenyl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 116509583 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-(2-bromo-4,6-dimethylphenyl)-3-propan-2-ylthiourea |
| SMILES | Cc1cc(C)c(NC(=S)NC(C)C)c(Br)c1 |
| InChI | InChI=1S/C12H17BrN2S/c1-7(2)14-12(16)15-11-9(4)5-8(3)6-10(11)13/h5-7H,1-4H3,(H2,14,15,16) |
| InChIKey | MUGDODWBCSNUJA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|