C18H22N4S2 — CID 5073311
1-methyl-3-[2-methyl-4-[3-methyl-4-(methylcarbamothioylamino)phenyl]phenyl]thiourea (PubChem CID 5073311) has the molecular formula C18H22N4S2 and a molecular weight of 358.54 g/mol. Its IUPAC name is 1-methyl-3-[2-methyl-4-[3-methyl-4-(methylcarbamothioylamino)phenyl]phenyl]thiourea.
| Compound Name | 1-methyl-3-[2-methyl-4-[3-methyl-4-(methylcarbamothioylamino)phenyl]phenyl]thiourea |
|---|---|
| PubChem CID | 5073311 |
| Molecular Formula | C18H22N4S2 |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-methyl-3-[2-methyl-4-[3-methyl-4-(methylcarbamothioylamino)phenyl]phenyl]thiourea |
| SMILES | CNC(=S)Nc1ccc(-c2ccc(NC(=S)NC)c(C)c2)cc1C |
| InChI | InChI=1S/C18H22N4S2/c1-11-9-13(5-7-15(11)21-17(23)19-3)14-6-8-16(12(2)10-14)22-18(24)20-4/h5-10H,1-4H3,(H2,19,21,23)(H2,20,22,24) |
| InChIKey | BWPKXJSVZJYFPA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|