C11H16N4S2 — CID 4276839
1-methyl-3-[2-methyl-3-(methylcarbamothioylamino)phenyl]thiourea (PubChem CID 4276839) has the molecular formula C11H16N4S2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 1-methyl-3-[2-methyl-3-(methylcarbamothioylamino)phenyl]thiourea.
| Compound Name | 1-methyl-3-[2-methyl-3-(methylcarbamothioylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 4276839 |
| Molecular Formula | C11H16N4S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-methyl-3-[2-methyl-3-(methylcarbamothioylamino)phenyl]thiourea |
| SMILES | CNC(=S)Nc1cccc(NC(=S)NC)c1C |
| InChI | InChI=1S/C11H16N4S2/c1-7-8(14-10(16)12-2)5-4-6-9(7)15-11(17)13-3/h4-6H,1-3H3,(H2,12,14,16)(H2,13,15,17) |
| InChIKey | HJTOXAADZNKYOZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|