C10H10N2O — CID 118563839
5-[(E)-hydroxyiminomethyl]-2,3-dimethylbenzonitrile (PubChem CID 118563839) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-[(E)-hydroxyiminomethyl]-2,3-dimethylbenzonitrile.
| Compound Name | 5-[(E)-hydroxyiminomethyl]-2,3-dimethylbenzonitrile |
|---|---|
| PubChem CID | 118563839 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5-[(E)-hydroxyiminomethyl]-2,3-dimethylbenzonitrile |
| SMILES | Cc1cc(/C=N/O)cc(C#N)c1C |
| InChI | InChI=1S/C10H10N2O/c1-7-3-9(6-12-13)4-10(5-11)8(7)2/h3-4,6,13H,1-2H3/b12-6+ |
| InChIKey | PMARHNSPRVWRTP-WUXMJOGZSA-N |
| XLogP | 1.98 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|