C9H10BNO2 — CID 167728304
(3-cyano-4,5-dimethylphenyl)boronic acid (PubChem CID 167728304) has the molecular formula C9H10BNO2 and a molecular weight of 175.00 g/mol. Its IUPAC name is (3-cyano-4,5-dimethylphenyl)boronic acid.
| Compound Name | (3-cyano-4,5-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 167728304 |
| Molecular Formula | C9H10BNO2 |
| Molecular Weight | 175.00 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (3-cyano-4,5-dimethylphenyl)boronic acid |
| SMILES | Cc1cc(B(O)O)cc(C#N)c1C |
| InChI | InChI=1S/C9H10BNO2/c1-6-3-9(10(12)13)4-8(5-11)7(6)2/h3-4,12-13H,1-2H3 |
| InChIKey | LSNNNQFUSMVNFM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.00 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|