About (3,4,5-tricyanophenyl)boronic acid
(3,4,5-tricyanophenyl)boronic acid (PubChem CID 130141628) has the molecular formula C9H4BN3O2
and a molecular weight of 196.96 g/mol. Its IUPAC name is (3,4,5-tricyanophenyl)boronic acid.
Molecular Properties
| Compound Name | (3,4,5-tricyanophenyl)boronic acid |
| PubChem CID | 130141628 |
| Molecular Formula | C9H4BN3O2 |
| Molecular Weight | 196.96 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | (3,4,5-tricyanophenyl)boronic acid |
| SMILES | N#Cc1cc(B(O)O)cc(C#N)c1C#N |
| InChI | InChI=1S/C9H4BN3O2/c11-3-6-1-8(10(14)15)2-7(4-12)9(6)5-13/h1-2,14-15H |
| InChIKey | AHEQXTOTHQWSMZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.96 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-tricyanophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-tricyanophenyl)boronic acid?
The IUPAC name of (3,4,5-tricyanophenyl)boronic acid (CID 130141628) is (3,4,5-tricyanophenyl)boronic acid.
What is the SMILES notation for (3,4,5-tricyanophenyl)boronic acid?
The canonical SMILES for (3,4,5-tricyanophenyl)boronic acid is N#Cc1cc(B(O)O)cc(C#N)c1C#N.
What is the InChIKey of (3,4,5-tricyanophenyl)boronic acid?
The InChIKey is AHEQXTOTHQWSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BN3O2/c11-3-6-1-8(10(14)15)2-7(4-12)9(6)5-13/h1-2,14-15H.
What are the key properties of (3,4,5-tricyanophenyl)boronic acid?
(3,4,5-tricyanophenyl)boronic acid has a molecular weight of 196.96 g/mol, XLogP of -1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-tricyanophenyl)boronic acid is sourced from PubChem (CID 130141628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).