C9H4BN3O2 — CID 130141628
(3,4,5-tricyanophenyl)boronic acid (PubChem CID 130141628) has the molecular formula C9H4BN3O2 and a molecular weight of 196.96 g/mol. Its IUPAC name is (3,4,5-tricyanophenyl)boronic acid.
| Compound Name | (3,4,5-tricyanophenyl)boronic acid |
|---|---|
| PubChem CID | 130141628 |
| Molecular Formula | C9H4BN3O2 |
| Molecular Weight | 196.96 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | (3,4,5-tricyanophenyl)boronic acid |
| SMILES | N#Cc1cc(B(O)O)cc(C#N)c1C#N |
| InChI | InChI=1S/C9H4BN3O2/c11-3-6-1-8(10(14)15)2-7(4-12)9(6)5-13/h1-2,14-15H |
| InChIKey | AHEQXTOTHQWSMZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.96 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|