C10H2N4S — CID 139892615
5-sulfanylbenzene-1,2,3,4-tetracarbonitrile (PubChem CID 139892615) has the molecular formula C10H2N4S and a molecular weight of 210.22 g/mol. Its IUPAC name is 5-sulfanylbenzene-1,2,3,4-tetracarbonitrile.
| Compound Name | 5-sulfanylbenzene-1,2,3,4-tetracarbonitrile |
|---|---|
| PubChem CID | 139892615 |
| Molecular Formula | C10H2N4S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 5-sulfanylbenzene-1,2,3,4-tetracarbonitrile |
| SMILES | N#Cc1cc(S)c(C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C10H2N4S/c11-2-6-1-10(15)9(5-14)8(4-13)7(6)3-12/h1,15H |
| InChIKey | RFWBFGQIDDOKQM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|