C10H12N2O — CID 117277341
5-(aminooxymethyl)-2,3-dimethylbenzonitrile (PubChem CID 117277341) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-(aminooxymethyl)-2,3-dimethylbenzonitrile.
| Compound Name | 5-(aminooxymethyl)-2,3-dimethylbenzonitrile |
|---|---|
| PubChem CID | 117277341 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-(aminooxymethyl)-2,3-dimethylbenzonitrile |
| SMILES | Cc1cc(CON)cc(C#N)c1C |
| InChI | InChI=1S/C10H12N2O/c1-7-3-9(6-13-12)4-10(5-11)8(7)2/h3-4H,6,12H2,1-2H3 |
| InChIKey | PZRJGCIAKHMMKA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|