C19H23NO5 — CID 68684071
methyl (2R)-1-(3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoyl)azetidine-2-carboxylate (PubChem CID 68684071) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl (2R)-1-(3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoyl)azetidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 68684071 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | methyl (2R)-1-(3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoyl)azetidine-2-carboxylate |
| SMILES | C=CCOc1c(CC=C)cc(C(=O)N2CC[C@@H]2C(=O)OC)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-5-7-13-11-14(12-16(23-3)17(13)25-10-6-2)18(21)20-9-8-15(20)19(22)24-4/h5-6,11-12,15H,1-2,7-10H2,3-4H3/t15-/m1/s1 |
| InChIKey | UGAAPRWXZVDEIJ-OAHLLOKOSA-N |
| XLogP | 2.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|