C61H48N6O8 — CID 59068735
ethyl N-[6-[bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate (PubChem CID 59068735) has the molecular formula C61H48N6O8 and a molecular weight of 993.09 g/mol. Its IUPAC name is ethyl N-[6-[bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate.
| Compound Name | ethyl N-[6-[bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 59068735 |
| Molecular Formula | C61H48N6O8 |
| Molecular Weight | 993.09 g/mol |
| Exact Mass | 992.35 |
| IUPAC Name | ethyl N-[6-[bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COC(=O)NCCCCCCNC(=O)N(CCCCCCNC(=O)OCC)C(=O)NCCCCCCNC(=O)OC#CC#CC#CC#CC#CC#CC#CC#CC#C |
| InChI | InChI=1S/C61H48N6O8/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-39-47-55-74-60(71)65-52-43-35-33-41-49-62-57(68)67(54-46-38-37-45-51-64-59(70)73-6-3)58(69)63-50-42-34-36-44-53-66-61(72)75-56-48-40-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h1-2H,6,33-38,41-46,49-54H2,3H3,(H,62,68)(H,63,69)(H,64,70)(H,65,71)(H,66,72) |
| InChIKey | BEGDEARSPHREBS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 75 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|