C28H52N4O6 — CID 58030728
methyl N-[6-[bis(8-oxononylcarbamoyl)amino]hexyl]carbamate (PubChem CID 58030728) has the molecular formula C28H52N4O6 and a molecular weight of 540.75 g/mol. Its IUPAC name is methyl N-[6-[bis(8-oxononylcarbamoyl)amino]hexyl]carbamate.
| Compound Name | methyl N-[6-[bis(8-oxononylcarbamoyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 58030728 |
| Molecular Formula | C28H52N4O6 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | methyl N-[6-[bis(8-oxononylcarbamoyl)amino]hexyl]carbamate |
| SMILES | COC(=O)NCCCCCCN(C(=O)NCCCCCCCC(C)=O)C(=O)NCCCCCCCC(C)=O |
| InChI | InChI=1S/C28H52N4O6/c1-24(33)18-12-6-4-8-14-20-29-26(35)32(23-17-11-10-16-22-31-28(37)38-3)27(36)30-21-15-9-5-7-13-19-25(2)34/h4-23H2,1-3H3,(H,29,35)(H,30,36)(H,31,37) |
| InChIKey | YSQHKJWAGLHTPX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|