C31H54N6O11 — CID 59456238
oxiran-2-yl N-[6-[bis[6-(oxiran-2-ylmethoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate (PubChem CID 59456238) has the molecular formula C31H54N6O11 and a molecular weight of 686.80 g/mol. Its IUPAC name is oxiran-2-yl N-[6-[bis[6-(oxiran-2-ylmethoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate.
| Compound Name | oxiran-2-yl N-[6-[bis[6-(oxiran-2-ylmethoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 59456238 |
| Molecular Formula | C31H54N6O11 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | oxiran-2-yl N-[6-[bis[6-(oxiran-2-ylmethoxycarbonylamino)hexylcarbamoyl]amino]hexyl]carbamate |
| SMILES | O=C(NCCCCCCNC(=O)N(CCCCCCNC(=O)OC1CO1)C(=O)NCCCCCCNC(=O)OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C31H54N6O11/c38-27(32-13-7-1-3-9-15-34-29(40)46-21-24-19-43-24)37(18-12-6-5-11-17-36-31(42)48-26-23-45-26)28(39)33-14-8-2-4-10-16-35-30(41)47-22-25-20-44-25/h24-26H,1-23H2,(H,32,38)(H,33,39)(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | UNKDGICIWZNJMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 214.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|