C36H65N5O11 — CID 161131339
oxiran-2-ylmethyl N-[6-[[8-(2-butoxyethoxycarbonylamino)octanoyl-[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]carbamoyl]amino]hexyl]carbamate (PubChem CID 161131339) has the molecular formula C36H65N5O11 and a molecular weight of 743.94 g/mol. Its IUPAC name is oxiran-2-ylmethyl N-[6-[[8-(2-butoxyethoxycarbonylamino)octanoyl-[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]carbamoyl]amino]hexyl]carbamate.
| Compound Name | oxiran-2-ylmethyl N-[6-[[8-(2-butoxyethoxycarbonylamino)octanoyl-[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]carbamoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 161131339 |
| Molecular Formula | C36H65N5O11 |
| Molecular Weight | 743.94 g/mol |
| Exact Mass | 743.47 |
| IUPAC Name | oxiran-2-ylmethyl N-[6-[[8-(2-butoxyethoxycarbonylamino)octanoyl-[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]carbamoyl]amino]hexyl]carbamate |
| SMILES | CCCCOCCOC(=O)NCCCCCCCC(=O)N(CCCCCCNC(=O)OCC1CO1)C(=O)NCCCCCCNC(=O)OCC1CO1 |
| InChI | InChI=1S/C36H65N5O11/c1-2-3-23-47-24-25-48-34(44)38-19-13-6-4-5-11-17-32(42)41(22-16-10-9-15-21-40-36(46)52-29-31-27-50-31)33(43)37-18-12-7-8-14-20-39-35(45)51-28-30-26-49-30/h30-31H,2-29H2,1H3,(H,37,43)(H,38,44)(H,39,45)(H,40,46) |
| InChIKey | QVQRSQJPPNFTJB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|