C44H91N3O16Si3 — CID 158945249
3-triethoxysilylpropyl 8-[3-triethoxysilylpropoxycarbonyl-[6-(3-triethoxysilylpropoxycarbonylamino)hexylcarbamoyl]amino]octanoate (PubChem CID 158945249) has the molecular formula C44H91N3O16Si3 and a molecular weight of 1002.47 g/mol. Its IUPAC name is 3-triethoxysilylpropyl 8-[3-triethoxysilylpropoxycarbonyl-[6-(3-triethoxysilylpropoxycarbonylamino)hexylcarbamoyl]amino]octanoate.
| Compound Name | 3-triethoxysilylpropyl 8-[3-triethoxysilylpropoxycarbonyl-[6-(3-triethoxysilylpropoxycarbonylamino)hexylcarbamoyl]amino]octanoate |
|---|---|
| PubChem CID | 158945249 |
| Molecular Formula | C44H91N3O16Si3 |
| Molecular Weight | 1002.47 g/mol |
| Exact Mass | 1001.57 |
| IUPAC Name | 3-triethoxysilylpropyl 8-[3-triethoxysilylpropoxycarbonyl-[6-(3-triethoxysilylpropoxycarbonylamino)hexylcarbamoyl]amino]octanoate |
| SMILES | CCO[Si](CCCOC(=O)CCCCCCCN(C(=O)NCCCCCCNC(=O)OCCC[Si](OCC)(OCC)OCC)C(=O)OCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C44H91N3O16Si3/c1-10-55-64(56-11-2,57-12-3)38-28-35-52-41(48)31-24-20-19-23-27-34-47(44(51)54-37-30-40-66(61-16-7,62-17-8)63-18-9)42(49)45-32-25-21-22-26-33-46-43(50)53-36-29-39-65(58-13-4,59-14-5)60-15-6/h10-40H2,1-9H3,(H,45,49)(H,46,50) |
| InChIKey | AAZPWECPAKMUEA-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 206.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.47 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|