C43H75N7O14 — CID 157236371
2-[6-[[6-(diethylaminooxycarbonylamino)hexyl-(2-prop-2-enoyloxyethoxycarbonyl)carbamoyl]amino]hexyl-[8-(diethylaminooxycarbonylamino)octanoyl]carbamoyl]oxyethyl prop-2-enoate (PubChem CID 157236371) has the molecular formula C43H75N7O14 and a molecular weight of 914.11 g/mol. Its IUPAC name is 2-[6-[[6-(diethylaminooxycarbonylamino)hexyl-(2-prop-2-enoyloxyethoxycarbonyl)carbamoyl]amino]hexyl-[8-(diethylaminooxycarbonylamino)octanoyl]carbamoyl]oxyethyl prop-2-enoate.
| Compound Name | 2-[6-[[6-(diethylaminooxycarbonylamino)hexyl-(2-prop-2-enoyloxyethoxycarbonyl)carbamoyl]amino]hexyl-[8-(diethylaminooxycarbonylamino)octanoyl]carbamoyl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 157236371 |
| Molecular Formula | C43H75N7O14 |
| Molecular Weight | 914.11 g/mol |
| Exact Mass | 913.54 |
| IUPAC Name | 2-[6-[[6-(diethylaminooxycarbonylamino)hexyl-(2-prop-2-enoyloxyethoxycarbonyl)carbamoyl]amino]hexyl-[8-(diethylaminooxycarbonylamino)octanoyl]carbamoyl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)N(CCCCCCNC(=O)N(CCCCCCNC(=O)ON(CC)CC)C(=O)OCCOC(=O)C=C)C(=O)CCCCCCCNC(=O)ON(CC)CC |
| InChI | InChI=1S/C43H75N7O14/c1-7-37(52)59-32-34-61-42(57)49(36(51)26-20-14-13-15-22-28-45-40(55)63-47(9-3)10-4)30-24-18-16-21-27-44-39(54)50(43(58)62-35-33-60-38(53)8-2)31-25-19-17-23-29-46-41(56)64-48(11-5)12-6/h7-8H,1-2,9-35H2,3-6H3,(H,44,54)(H,45,55)(H,46,56) |
| InChIKey | AURKVZIZGIGYFZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 240.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.11 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|