C16H31NO2 — CID 156566724
(E)-5-(2,2-dimethylpropoxy)-2,2-dimethyl-N-(2-methylpropyl)pent-3-enamide (PubChem CID 156566724) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (E)-5-(2,2-dimethylpropoxy)-2,2-dimethyl-N-(2-methylpropyl)pent-3-enamide.
| Compound Name | (E)-5-(2,2-dimethylpropoxy)-2,2-dimethyl-N-(2-methylpropyl)pent-3-enamide |
|---|---|
| PubChem CID | 156566724 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (E)-5-(2,2-dimethylpropoxy)-2,2-dimethyl-N-(2-methylpropyl)pent-3-enamide |
| SMILES | CC(C)CNC(=O)C(C)(C)/C=C/COCC(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-13(2)11-17-14(18)16(6,7)9-8-10-19-12-15(3,4)5/h8-9,13H,10-12H2,1-7H3,(H,17,18)/b9-8+ |
| InChIKey | KDEOECIYQPIESG-CMDGGOBGSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|