C14H27F2NO2 — CID 153306593
2,2-difluoro-6-(2-methylpropoxy)-N-(2-methylpropyl)hexanamide (PubChem CID 153306593) has the molecular formula C14H27F2NO2 and a molecular weight of 279.37 g/mol. Its IUPAC name is 2,2-difluoro-6-(2-methylpropoxy)-N-(2-methylpropyl)hexanamide.
| Compound Name | 2,2-difluoro-6-(2-methylpropoxy)-N-(2-methylpropyl)hexanamide |
|---|---|
| PubChem CID | 153306593 |
| Molecular Formula | C14H27F2NO2 |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2,2-difluoro-6-(2-methylpropoxy)-N-(2-methylpropyl)hexanamide |
| SMILES | CC(C)CNC(=O)C(F)(F)CCCCOCC(C)C |
| InChI | InChI=1S/C14H27F2NO2/c1-11(2)9-17-13(18)14(15,16)7-5-6-8-19-10-12(3)4/h11-12H,5-10H2,1-4H3,(H,17,18) |
| InChIKey | YOTFLHUPGWEZOV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|