C14H29NO3 — CID 159676352
1-[2-(2,2-dimethylpropoxy)ethoxy]-6-(methylamino)hexan-3-one (PubChem CID 159676352) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpropoxy)ethoxy]-6-(methylamino)hexan-3-one.
| Compound Name | 1-[2-(2,2-dimethylpropoxy)ethoxy]-6-(methylamino)hexan-3-one |
|---|---|
| PubChem CID | 159676352 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 1-[2-(2,2-dimethylpropoxy)ethoxy]-6-(methylamino)hexan-3-one |
| SMILES | CNCCCC(=O)CCOCCOCC(C)(C)C |
| InChI | InChI=1S/C14H29NO3/c1-14(2,3)12-18-11-10-17-9-7-13(16)6-5-8-15-4/h15H,5-12H2,1-4H3 |
| InChIKey | KROACLUSKPFPRA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|