C19H37NO4 — CID 161203588
3,3-dimethyl-N-[7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-oxoheptyl]butanamide (PubChem CID 161203588) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is 3,3-dimethyl-N-[7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-oxoheptyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-oxoheptyl]butanamide |
|---|---|
| PubChem CID | 161203588 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 3,3-dimethyl-N-[7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-oxoheptyl]butanamide |
| SMILES | CC(C)(C)CC(=O)NCCCC(=O)CCCOCCOC(C)(C)C |
| InChI | InChI=1S/C19H37NO4/c1-18(2,3)15-17(22)20-11-7-9-16(21)10-8-12-23-13-14-24-19(4,5)6/h7-15H2,1-6H3,(H,20,22) |
| InChIKey | HYZFLRKECWQLIX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|