C41H78O8 — CID 159668133
1-(3,3-dimethylbutoxy)-9-(3-methylbutoxy)nonane-4,6-dione;1-(4,4-dimethylpentoxy)-9-(2,2-dimethylpropoxy)nonane-3,5-dione (PubChem CID 159668133) has the molecular formula C41H78O8 and a molecular weight of 699.07 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-9-(3-methylbutoxy)nonane-4,6-dione;1-(4,4-dimethylpentoxy)-9-(2,2-dimethylpropoxy)nonane-3,5-dione.
| Compound Name | 1-(3,3-dimethylbutoxy)-9-(3-methylbutoxy)nonane-4,6-dione;1-(4,4-dimethylpentoxy)-9-(2,2-dimethylpropoxy)nonane-3,5-dione |
|---|---|
| PubChem CID | 159668133 |
| Molecular Formula | C41H78O8 |
| Molecular Weight | 699.07 g/mol |
| Exact Mass | 698.57 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-9-(3-methylbutoxy)nonane-4,6-dione;1-(4,4-dimethylpentoxy)-9-(2,2-dimethylpropoxy)nonane-3,5-dione |
| SMILES | CC(C)(C)CCCOCCC(=O)CC(=O)CCCCOCC(C)(C)C.CC(C)CCOCCCC(=O)CC(=O)CCCOCCC(C)(C)C |
| InChI | InChI=1S/C21H40O4.C20H38O4/c1-20(2,3)12-9-14-24-15-11-19(23)16-18(22)10-7-8-13-25-17-21(4,5)6;1-17(2)10-14-23-12-6-8-18(21)16-19(22)9-7-13-24-15-11-20(3,4)5/h7-17H2,1-6H3;17H,6-16H2,1-5H3 |
| InChIKey | MTRFPPACFHAKJH-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.07 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|