C16H31I2N5O5 — CID 90446025
3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[5-(diiodoamino)pentyl]propanamide (PubChem CID 90446025) has the molecular formula C16H31I2N5O5 and a molecular weight of 627.26 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[5-(diiodoamino)pentyl]propanamide.
| Compound Name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[5-(diiodoamino)pentyl]propanamide |
|---|---|
| PubChem CID | 90446025 |
| Molecular Formula | C16H31I2N5O5 |
| Molecular Weight | 627.26 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[5-(diiodoamino)pentyl]propanamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCC(=O)NCCCCCN(I)I |
| InChI | InChI=1S/C16H31I2N5O5/c17-23(18)7-3-1-2-5-20-16(24)4-8-25-10-12-27-14-15-28-13-11-26-9-6-21-22-19/h1-15H2,(H,20,24) |
| InChIKey | GERWRLZFQQPWIU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|