C23H47N9O6 — CID 170227083
N-(3-aminopropyl)-3-[2,2-bis[[3-(3-aminopropylamino)-3-oxopropoxy]methyl]-3-azidopropoxy]propanamide (PubChem CID 170227083) has the molecular formula C23H47N9O6 and a molecular weight of 545.69 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[2,2-bis[[3-(3-aminopropylamino)-3-oxopropoxy]methyl]-3-azidopropoxy]propanamide.
| Compound Name | N-(3-aminopropyl)-3-[2,2-bis[[3-(3-aminopropylamino)-3-oxopropoxy]methyl]-3-azidopropoxy]propanamide |
|---|---|
| PubChem CID | 170227083 |
| Molecular Formula | C23H47N9O6 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.36 |
| IUPAC Name | N-(3-aminopropyl)-3-[2,2-bis[[3-(3-aminopropylamino)-3-oxopropoxy]methyl]-3-azidopropoxy]propanamide |
| SMILES | [N-]=[N+]=NCC(COCCC(=O)NCCCN)(COCCC(=O)NCCCN)COCCC(=O)NCCCN |
| InChI | InChI=1S/C23H47N9O6/c24-7-1-10-28-20(33)4-13-36-17-23(16-31-32-27,18-37-14-5-21(34)29-11-2-8-25)19-38-15-6-22(35)30-12-3-9-26/h1-19,24-26H2,(H,28,33)(H,29,34)(H,30,35) |
| InChIKey | PIJIPDJSSYCBJS-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 241.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|