C12H23NO4 — CID 169024379
propan-2-yl N-[2-(4-methyl-3-oxopentoxy)ethyl]carbamate (PubChem CID 169024379) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is propan-2-yl N-[2-(4-methyl-3-oxopentoxy)ethyl]carbamate.
| Compound Name | propan-2-yl N-[2-(4-methyl-3-oxopentoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 169024379 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | propan-2-yl N-[2-(4-methyl-3-oxopentoxy)ethyl]carbamate |
| SMILES | CC(C)OC(=O)NCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C12H23NO4/c1-9(2)11(14)5-7-16-8-6-13-12(15)17-10(3)4/h9-10H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | VVQZFAMXAKKDQK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|