C8H18NO8P — CID 139583363
ethyl N-[2-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxyethyl]carbamate (PubChem CID 139583363) has the molecular formula C8H18NO8P and a molecular weight of 287.21 g/mol. Its IUPAC name is ethyl N-[2-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxyethyl]carbamate.
| Compound Name | ethyl N-[2-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 139583363 |
| Molecular Formula | C8H18NO8P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | ethyl N-[2-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxyethyl]carbamate |
| SMILES | CCOC(=O)NCCOP(=O)(O)OC[C@H](O)CO |
| InChI | InChI=1S/C8H18NO8P/c1-2-15-8(12)9-3-4-16-18(13,14)17-6-7(11)5-10/h7,10-11H,2-6H2,1H3,(H,9,12)(H,13,14)/t7-/m1/s1 |
| InChIKey | HFDKDPCCICZZPW-SSDOTTSWSA-N |
| XLogP | -0.78 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|