C12H24N2O7 — CID 139375918
3-[[2-(1-amino-2-hydroxyethoxy)-2-[(2-methylpropan-2-yl)oxy]ethoxy]carbonylamino]propanoic acid (PubChem CID 139375918) has the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-[[2-(1-amino-2-hydroxyethoxy)-2-[(2-methylpropan-2-yl)oxy]ethoxy]carbonylamino]propanoic acid.
| Compound Name | 3-[[2-(1-amino-2-hydroxyethoxy)-2-[(2-methylpropan-2-yl)oxy]ethoxy]carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 139375918 |
| Molecular Formula | C12H24N2O7 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-[[2-(1-amino-2-hydroxyethoxy)-2-[(2-methylpropan-2-yl)oxy]ethoxy]carbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(COC(=O)NCCC(=O)O)OC(N)CO |
| InChI | InChI=1S/C12H24N2O7/c1-12(2,3)21-10(20-8(13)6-15)7-19-11(18)14-5-4-9(16)17/h8,10,15H,4-7,13H2,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | AVGKJYSILKRKKU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|