C13H26N2O6S2 — CID 118930170
[2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] N-[3-[2-(methyldisulfanyl)ethylamino]-3-oxopropyl]carbamate (PubChem CID 118930170) has the molecular formula C13H26N2O6S2 and a molecular weight of 370.49 g/mol. Its IUPAC name is [2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] N-[3-[2-(methyldisulfanyl)ethylamino]-3-oxopropyl]carbamate.
| Compound Name | [2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] N-[3-[2-(methyldisulfanyl)ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 118930170 |
| Molecular Formula | C13H26N2O6S2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] N-[3-[2-(methyldisulfanyl)ethylamino]-3-oxopropyl]carbamate |
| SMILES | CCC(CO)OC(O)COC(=O)NCCC(=O)NCCSSC |
| InChI | InChI=1S/C13H26N2O6S2/c1-3-10(8-16)21-12(18)9-20-13(19)15-5-4-11(17)14-6-7-23-22-2/h10,12,16,18H,3-9H2,1-2H3,(H,14,17)(H,15,19) |
| InChIKey | BSCJJNHQSOFLBB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|