C12H23NO7S — CID 122463070
[2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] [3-oxo-3-(2-sulfanylethylamino)propyl] carbonate (PubChem CID 122463070) has the molecular formula C12H23NO7S and a molecular weight of 325.38 g/mol. Its IUPAC name is [2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] [3-oxo-3-(2-sulfanylethylamino)propyl] carbonate.
| Compound Name | [2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] [3-oxo-3-(2-sulfanylethylamino)propyl] carbonate |
|---|---|
| PubChem CID | 122463070 |
| Molecular Formula | C12H23NO7S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [2-hydroxy-2-(1-hydroxybutan-2-yloxy)ethyl] [3-oxo-3-(2-sulfanylethylamino)propyl] carbonate |
| SMILES | CCC(CO)OC(O)COC(=O)OCCC(=O)NCCS |
| InChI | InChI=1S/C12H23NO7S/c1-2-9(7-14)20-11(16)8-19-12(17)18-5-3-10(15)13-4-6-21/h9,11,14,16,21H,2-8H2,1H3,(H,13,15) |
| InChIKey | ZKDXHVQPQUTAKC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|