About CID 154612724
CID 154612724 (PubChem CID 154612724) has the molecular formula C7H14O3Si
and a molecular weight of 174.27 g/mol.
Molecular Properties
| Compound Name | CID 154612724 |
| PubChem CID | 154612724 |
| Molecular Formula | C7H14O3Si |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | — |
| SMILES | CO[Si]CCOC(=O)C(C)C |
| InChI | InChI=1S/C7H14O3Si/c1-6(2)7(8)10-4-5-11-9-3/h6H,4-5H2,1-3H3 |
| InChIKey | NHGAAJUKYSGYAB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 154612724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154612724?
The IUPAC name of CID 154612724 (CID 154612724) is not available.
What is the SMILES notation for CID 154612724?
The canonical SMILES for CID 154612724 is CO[Si]CCOC(=O)C(C)C.
What is the InChIKey of CID 154612724?
The InChIKey is NHGAAJUKYSGYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3Si/c1-6(2)7(8)10-4-5-11-9-3/h6H,4-5H2,1-3H3.
What are the key properties of CID 154612724?
CID 154612724 has a molecular weight of 174.27 g/mol, XLogP of 0.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154612724 is sourced from PubChem (CID 154612724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).