C14H28O3 — CID 21363535
1-tert-butyl-1-(2,2-dimethoxyethoxymethyl)cyclopentane (PubChem CID 21363535) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 1-tert-butyl-1-(2,2-dimethoxyethoxymethyl)cyclopentane.
| Compound Name | 1-tert-butyl-1-(2,2-dimethoxyethoxymethyl)cyclopentane |
|---|---|
| PubChem CID | 21363535 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1-tert-butyl-1-(2,2-dimethoxyethoxymethyl)cyclopentane |
| SMILES | COC(COCC1(C(C)(C)C)CCCC1)OC |
| InChI | InChI=1S/C14H28O3/c1-13(2,3)14(8-6-7-9-14)11-17-10-12(15-4)16-5/h12H,6-11H2,1-5H3 |
| InChIKey | UTMRUVZERLLZCH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|